C22H20Br2F3IO3 — CID 102140563
4-[4,4-bis(4-bromophenyl)-3-iodobut-3-enoxy]butyl 2,2,2-trifluoroacetate (PubChem CID 102140563) has the molecular formula C22H20Br2F3IO3 and a molecular weight of 676.11 g/mol. Its IUPAC name is 4-[4,4-bis(4-bromophenyl)-3-iodobut-3-enoxy]butyl 2,2,2-trifluoroacetate.
| Compound Name | 4-[4,4-bis(4-bromophenyl)-3-iodobut-3-enoxy]butyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102140563 |
| Molecular Formula | C22H20Br2F3IO3 |
| Molecular Weight | 676.11 g/mol |
| Exact Mass | 673.88 |
| IUPAC Name | 4-[4,4-bis(4-bromophenyl)-3-iodobut-3-enoxy]butyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCCCOCCC(I)=C(c1ccc(Br)cc1)c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H20Br2F3IO3/c23-17-7-3-15(4-8-17)20(16-5-9-18(24)10-6-16)19(28)11-14-30-12-1-2-13-31-21(29)22(25,26)27/h3-10H,1-2,11-14H2 |
| InChIKey | QWDGOKBWVIFLSC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.11 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|