C18H11F17O2 — CID 25227838
4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)benzoic acid (PubChem CID 25227838) has the molecular formula C18H11F17O2 and a molecular weight of 582.25 g/mol. Its IUPAC name is 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)benzoic acid.
| Compound Name | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)benzoic acid |
|---|---|
| PubChem CID | 25227838 |
| Molecular Formula | C18H11F17O2 |
| Molecular Weight | 582.25 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F17O2/c19-11(20,7-1-2-8-3-5-9(6-4-8)10(36)37)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h3-6H,1-2,7H2,(H,36,37) |
| InChIKey | HQUOACZZEBCHQE-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.25 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|