C37H27F39O5 — CID 101023715
3,4,5-tris(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)benzoic acid (PubChem CID 101023715) has the molecular formula C37H27F39O5 and a molecular weight of 1292.54 g/mol. Its IUPAC name is 3,4,5-tris(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)benzoic acid.
| Compound Name | 3,4,5-tris(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)benzoic acid |
|---|---|
| PubChem CID | 101023715 |
| Molecular Formula | C37H27F39O5 |
| Molecular Weight | 1292.54 g/mol |
| Exact Mass | 1292.12 |
| IUPAC Name | 3,4,5-tris(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)benzoic acid |
| SMILES | O=C(O)c1cc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C37H27F39O5/c38-20(39,23(44,45)26(50,51)29(56,57)32(62,63)35(68,69)70)7-1-4-10-79-16-13-15(19(77)78)14-17(80-11-5-2-8-21(40,41)24(46,47)27(52,53)30(58,59)33(64,65)36(71,72)73)18(16)81-12-6-3-9-22(42,43)25(48,49)28(54,55)31(60,61)34(66,67)37(74,75)76/h13-14H,1-12H2,(H,77,78) |
| InChIKey | DTKASBPCKSUJKY-UHFFFAOYSA-N |
| XLogP | 17.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1292.54 |
| LogP ≤ 5 | 17.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|