C35H23F39O5 — CID 101495125
methyl 3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)benzoate (PubChem CID 101495125) has the molecular formula C35H23F39O5 and a molecular weight of 1264.49 g/mol. Its IUPAC name is methyl 3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)benzoate.
| Compound Name | methyl 3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)benzoate |
|---|---|
| PubChem CID | 101495125 |
| Molecular Formula | C35H23F39O5 |
| Molecular Weight | 1264.49 g/mol |
| Exact Mass | 1264.09 |
| IUPAC Name | methyl 3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)benzoate |
| SMILES | COC(=O)c1cc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C35H23F39O5/c1-76-17(75)13-11-14(77-8-2-5-18(36,37)21(42,43)24(48,49)27(54,55)30(60,61)33(66,67)68)16(79-10-4-7-20(40,41)23(46,47)26(52,53)29(58,59)32(64,65)35(72,73)74)15(12-13)78-9-3-6-19(38,39)22(44,45)25(50,51)28(56,57)31(62,63)34(69,70)71/h11-12H,2-10H2,1H3 |
| InChIKey | RIRPZGHDEZKICS-UHFFFAOYSA-N |
| XLogP | 16.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1264.49 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|