C44H28BrF51O5 — CID 87533394
[3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methyl 2-bromo-2-methylpropanoate (PubChem CID 87533394) has the molecular formula C44H28BrF51O5 and a molecular weight of 1685.51 g/mol. Its IUPAC name is [3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methyl 2-bromo-2-methylpropanoate.
| Compound Name | [3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 87533394 |
| Molecular Formula | C44H28BrF51O5 |
| Molecular Weight | 1685.51 g/mol |
| Exact Mass | 1684.03 |
| IUPAC Name | [3,4,5-tris(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCc1cc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C44H28BrF51O5/c1-20(2,45)19(97)101-14-15-12-16(98-9-3-6-21(46,47)24(52,53)27(58,59)30(64,65)33(70,71)36(76,77)39(82,83)42(88,89)90)18(100-11-5-8-23(50,51)26(56,57)29(62,63)32(68,69)35(74,75)38(80,81)41(86,87)44(94,95)96)17(13-15)99-10-4-7-22(48,49)25(54,55)28(60,61)31(66,67)34(72,73)37(78,79)40(84,85)43(91,92)93/h12-13H,3-11,14H2,1-2H3 |
| InChIKey | TTYSCPPXIQHYKE-UHFFFAOYSA-N |
| XLogP | 21.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1685.51 |
| LogP ≤ 5 | 21.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|