C60H69F27O6 — CID 101266773
2,6,11-triheptoxy-3,7,10-tris(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)triphenylene (PubChem CID 101266773) has the molecular formula C60H69F27O6 and a molecular weight of 1399.15 g/mol. Its IUPAC name is 2,6,11-triheptoxy-3,7,10-tris(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)triphenylene.
| Compound Name | 2,6,11-triheptoxy-3,7,10-tris(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)triphenylene |
|---|---|
| PubChem CID | 101266773 |
| Molecular Formula | C60H69F27O6 |
| Molecular Weight | 1399.15 g/mol |
| Exact Mass | 1398.47 |
| IUPAC Name | 2,6,11-triheptoxy-3,7,10-tris(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)triphenylene |
| SMILES | CCCCCCCOc1cc2c3cc(OCCCCCCC)c(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3c3cc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OCCCCCCC)cc3c2cc1OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C60H69F27O6/c1-4-7-10-13-16-25-88-43-31-37-38-32-44(89-26-17-14-11-8-5-2)47(92-29-20-23-50(63,64)53(69,70)56(75,76)59(82,83)84)35-41(38)42-36-48(93-30-21-24-51(65,66)54(71,72)57(77,78)60(85,86)87)45(90-27-18-15-12-9-6-3)33-39(42)40(37)34-46(43)91-28-19-22-49(61,62)52(67,68)55(73,74)58(79,80)81/h31-36H,4-30H2,1-3H3 |
| InChIKey | KJPSMOLXCTUNIV-UHFFFAOYSA-N |
| XLogP | 23.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1399.15 |
| LogP ≤ 5 | 23.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|