C18H13F13O5 — CID 52911532
dimethyl 5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzene-1,3-dicarboxylate (PubChem CID 52911532) has the molecular formula C18H13F13O5 and a molecular weight of 556.27 g/mol. Its IUPAC name is dimethyl 5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 52911532 |
| Molecular Formula | C18H13F13O5 |
| Molecular Weight | 556.27 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | dimethyl 5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H13F13O5/c1-34-11(32)8-5-9(12(33)35-2)7-10(6-8)36-4-3-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h5-7H,3-4H2,1-2H3 |
| InChIKey | KJEACVMRWBTYCN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.27 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|