C41H55F17N2O6 — CID 102220064
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate (PubChem CID 102220064) has the molecular formula C41H55F17N2O6 and a molecular weight of 994.86 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate |
|---|---|
| PubChem CID | 102220064 |
| Molecular Formula | C41H55F17N2O6 |
| Molecular Weight | 994.86 g/mol |
| Exact Mass | 994.38 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate |
| SMILES | CCCCCCNC(=O)CCCCCOc1cc(OCCCCCC(=O)NCCCCCC)cc(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C41H55F17N2O6/c1-3-5-7-13-20-59-31(61)17-11-9-15-22-64-29-25-28(26-30(27-29)65-23-16-10-12-18-32(62)60-21-14-8-6-4-2)33(63)66-24-19-34(42,43)35(44,45)36(46,47)37(48,49)38(50,51)39(52,53)40(54,55)41(56,57)58/h25-27H,3-24H2,1-2H3,(H,59,61)(H,60,62) |
| InChIKey | DWVVFGDJMAFUJK-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.86 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|