C52H91N5O6 — CID 101476796
9-(1-decyltriazol-4-yl)nonyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate (PubChem CID 101476796) has the molecular formula C52H91N5O6 and a molecular weight of 882.33 g/mol. Its IUPAC name is 9-(1-decyltriazol-4-yl)nonyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate.
| Compound Name | 9-(1-decyltriazol-4-yl)nonyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate |
|---|---|
| PubChem CID | 101476796 |
| Molecular Formula | C52H91N5O6 |
| Molecular Weight | 882.33 g/mol |
| Exact Mass | 881.70 |
| IUPAC Name | 9-(1-decyltriazol-4-yl)nonyl 3,5-bis[6-(hexylamino)-6-oxohexoxy]benzoate |
| SMILES | CCCCCCCCCCn1cc(CCCCCCCCCOC(=O)c2cc(OCCCCCC(=O)NCCCCCC)cc(OCCCCCC(=O)NCCCCCC)c2)nn1 |
| InChI | InChI=1S/C52H91N5O6/c1-4-7-10-13-14-17-20-29-38-57-45-47(55-56-57)33-24-19-16-15-18-21-30-41-63-52(60)46-42-48(61-39-31-22-25-34-50(58)53-36-27-11-8-5-2)44-49(43-46)62-40-32-23-26-35-51(59)54-37-28-12-9-6-3/h42-45H,4-41H2,1-3H3,(H,53,58)(H,54,59) |
| InChIKey | STYPXODERMQOCT-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.33 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|