C34H59N7O3 — CID 90942286
tert-butyl 2-amino-4-[5-[1-[2-(heptadec-8-enoylamino)ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate (PubChem CID 90942286) has the molecular formula C34H59N7O3 and a molecular weight of 613.89 g/mol. Its IUPAC name is tert-butyl 2-amino-4-[5-[1-[2-(heptadec-8-enoylamino)ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 2-amino-4-[5-[1-[2-(heptadec-8-enoylamino)ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 90942286 |
| Molecular Formula | C34H59N7O3 |
| Molecular Weight | 613.89 g/mol |
| Exact Mass | 613.47 |
| IUPAC Name | tert-butyl 2-amino-4-[5-[1-[2-(heptadec-8-enoylamino)ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate |
| SMILES | CCCCCCCCC=CCCCCCCC(=O)NCCn1cc(CCCCCc2cn(C(=O)OC(C)(C)C)c(N)n2)nn1 |
| InChI | InChI=1S/C34H59N7O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-31(42)36-25-26-40-27-30(38-39-40)23-20-18-19-22-29-28-41(32(35)37-29)33(43)44-34(2,3)4/h12-13,27-28H,5-11,14-26H2,1-4H3,(H2,35,37)(H,36,42) |
| InChIKey | KCCJLMPZZQMRMJ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.89 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|