C28H41N7O3 — CID 90931018
tert-butyl 2-amino-4-[5-[1-[2-[(4-tert-butylbenzoyl)amino]ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate (PubChem CID 90931018) has the molecular formula C28H41N7O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is tert-butyl 2-amino-4-[5-[1-[2-[(4-tert-butylbenzoyl)amino]ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 2-amino-4-[5-[1-[2-[(4-tert-butylbenzoyl)amino]ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 90931018 |
| Molecular Formula | C28H41N7O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | tert-butyl 2-amino-4-[5-[1-[2-[(4-tert-butylbenzoyl)amino]ethyl]triazol-4-yl]pentyl]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CCCCCc2cn(CCNC(=O)c3ccc(C(C)(C)C)cc3)nn2)nc1N |
| InChI | InChI=1S/C28H41N7O3/c1-27(2,3)21-14-12-20(13-15-21)24(36)30-16-17-34-18-23(32-33-34)11-9-7-8-10-22-19-35(25(29)31-22)26(37)38-28(4,5)6/h12-15,18-19H,7-11,16-17H2,1-6H3,(H2,29,31)(H,30,36) |
| InChIKey | KGVWILJQXBUXKP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|