C33H42ClN7O — CID 71497930
N-[2-[4-[5-[2-amino-3-[(4-ethynylphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide;hydrochloride (PubChem CID 71497930) has the molecular formula C33H42ClN7O and a molecular weight of 588.20 g/mol. Its IUPAC name is N-[2-[4-[5-[2-amino-3-[(4-ethynylphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide;hydrochloride.
| Compound Name | N-[2-[4-[5-[2-amino-3-[(4-ethynylphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 71497930 |
| Molecular Formula | C33H42ClN7O |
| Molecular Weight | 588.20 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | N-[2-[4-[5-[2-amino-3-[(4-ethynylphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide;hydrochloride |
| SMILES | C#Cc1ccc(Cn2c(CCCCCc3cn(CCNC(=O)c4ccc(CCCCC)cc4)nn3)cnc2N)cc1.Cl |
| InChI | InChI=1S/C33H41N7O.ClH/c1-3-5-7-10-27-17-19-29(20-18-27)32(41)35-21-22-39-25-30(37-38-39)11-8-6-9-12-31-23-36-33(34)40(31)24-28-15-13-26(4-2)14-16-28;/h2,13-20,23,25H,3,5-12,21-22,24H2,1H3,(H2,34,36)(H,35,41);1H |
| InChIKey | VLZYHUKGTYEXNU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.20 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|