C23H35N7O — CID 70964434
N-[2-[4-[5-(2-amino-4,5-dihydro-1H-imidazol-5-yl)pentyl]triazol-1-yl]ethyl]-4-butylbenzamide (PubChem CID 70964434) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[2-[4-[5-(2-amino-4,5-dihydro-1H-imidazol-5-yl)pentyl]triazol-1-yl]ethyl]-4-butylbenzamide.
| Compound Name | N-[2-[4-[5-(2-amino-4,5-dihydro-1H-imidazol-5-yl)pentyl]triazol-1-yl]ethyl]-4-butylbenzamide |
|---|---|
| PubChem CID | 70964434 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | N-[2-[4-[5-(2-amino-4,5-dihydro-1H-imidazol-5-yl)pentyl]triazol-1-yl]ethyl]-4-butylbenzamide |
| SMILES | CCCCc1ccc(C(=O)NCCn2cc(CCCCCC3CN=C(N)N3)nn2)cc1 |
| InChI | InChI=1S/C23H35N7O/c1-2-3-7-18-10-12-19(13-11-18)22(31)25-14-15-30-17-21(28-29-30)9-6-4-5-8-20-16-26-23(24)27-20/h10-13,17,20H,2-9,14-16H2,1H3,(H,25,31)(H3,24,26,27) |
| InChIKey | FUTKGNOGVRQFPX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|