C34H47N7O2 — CID 71497845
N-[2-[4-[5-[2-amino-3-[(4-propoxyphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide (PubChem CID 71497845) has the molecular formula C34H47N7O2 and a molecular weight of 585.80 g/mol. Its IUPAC name is N-[2-[4-[5-[2-amino-3-[(4-propoxyphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide.
| Compound Name | N-[2-[4-[5-[2-amino-3-[(4-propoxyphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 71497845 |
| Molecular Formula | C34H47N7O2 |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | N-[2-[4-[5-[2-amino-3-[(4-propoxyphenyl)methyl]imidazol-4-yl]pentyl]triazol-1-yl]ethyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCCn2cc(CCCCCc3cnc(N)n3Cc3ccc(OCCC)cc3)nn2)cc1 |
| InChI | InChI=1S/C34H47N7O2/c1-3-5-7-10-27-13-17-29(18-14-27)33(42)36-21-22-40-26-30(38-39-40)11-8-6-9-12-31-24-37-34(35)41(31)25-28-15-19-32(20-16-28)43-23-4-2/h13-20,24,26H,3-12,21-23,25H2,1-2H3,(H2,35,37)(H,36,42) |
| InChIKey | KRJFGHYDTKNRSN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|