C27H32BrN5O — CID 90666383
N-[2-[4-[(2-bromo-1H-indol-3-yl)methyl]triazol-1-yl]ethyl]-4-heptylbenzamide (PubChem CID 90666383) has the molecular formula C27H32BrN5O and a molecular weight of 522.49 g/mol. Its IUPAC name is N-[2-[4-[(2-bromo-1H-indol-3-yl)methyl]triazol-1-yl]ethyl]-4-heptylbenzamide.
| Compound Name | N-[2-[4-[(2-bromo-1H-indol-3-yl)methyl]triazol-1-yl]ethyl]-4-heptylbenzamide |
|---|---|
| PubChem CID | 90666383 |
| Molecular Formula | C27H32BrN5O |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[2-[4-[(2-bromo-1H-indol-3-yl)methyl]triazol-1-yl]ethyl]-4-heptylbenzamide |
| SMILES | CCCCCCCc1ccc(C(=O)NCCn2cc(Cc3c(Br)[nH]c4ccccc34)nn2)cc1 |
| InChI | InChI=1S/C27H32BrN5O/c1-2-3-4-5-6-9-20-12-14-21(15-13-20)27(34)29-16-17-33-19-22(31-32-33)18-24-23-10-7-8-11-25(23)30-26(24)28/h7-8,10-15,19,30H,2-6,9,16-18H2,1H3,(H,29,34) |
| InChIKey | YFDDOBJAUCASFQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|