C17H24N4O2 — CID 119055237
N-butyl-4-[4-(phenoxymethyl)triazol-1-yl]butanamide (PubChem CID 119055237) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-butyl-4-[4-(phenoxymethyl)triazol-1-yl]butanamide.
| Compound Name | N-butyl-4-[4-(phenoxymethyl)triazol-1-yl]butanamide |
|---|---|
| PubChem CID | 119055237 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-butyl-4-[4-(phenoxymethyl)triazol-1-yl]butanamide |
| SMILES | CCCCNC(=O)CCCn1cc(COc2ccccc2)nn1 |
| InChI | InChI=1S/C17H24N4O2/c1-2-3-11-18-17(22)10-7-12-21-13-15(19-20-21)14-23-16-8-5-4-6-9-16/h4-6,8-9,13H,2-3,7,10-12,14H2,1H3,(H,18,22) |
| InChIKey | YOVAROSNPFVMKC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|