C10H17N4O2S- — CID 144515281
3-[3-[4-(methoxymethyl)triazol-1-yl]propylamino]-3-oxopropane-1-thiolate (PubChem CID 144515281) has the molecular formula C10H17N4O2S- and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-[3-[4-(methoxymethyl)triazol-1-yl]propylamino]-3-oxopropane-1-thiolate.
| Compound Name | 3-[3-[4-(methoxymethyl)triazol-1-yl]propylamino]-3-oxopropane-1-thiolate |
|---|---|
| PubChem CID | 144515281 |
| Molecular Formula | C10H17N4O2S- |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[3-[4-(methoxymethyl)triazol-1-yl]propylamino]-3-oxopropane-1-thiolate |
| SMILES | COCc1cn(CCCNC(=O)CC[S-])nn1 |
| InChI | InChI=1S/C10H18N4O2S/c1-16-8-9-7-14(13-12-9)5-2-4-11-10(15)3-6-17/h7,17H,2-6,8H2,1H3,(H,11,15)/p-1 |
| InChIKey | YCOJXKMSOAYCFC-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|