C15H31N4OP — CID 153389003
ethane;N-[3-(4-ethyltriazol-1-yl)propyl]-6-phosphanylhexanamide (PubChem CID 153389003) has the molecular formula C15H31N4OP and a molecular weight of 314.41 g/mol. Its IUPAC name is ethane;N-[3-(4-ethyltriazol-1-yl)propyl]-6-phosphanylhexanamide.
| Compound Name | ethane;N-[3-(4-ethyltriazol-1-yl)propyl]-6-phosphanylhexanamide |
|---|---|
| PubChem CID | 153389003 |
| Molecular Formula | C15H31N4OP |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ethane;N-[3-(4-ethyltriazol-1-yl)propyl]-6-phosphanylhexanamide |
| SMILES | CC.CCc1cn(CCCNC(=O)CCCCCP)nn1 |
| InChI | InChI=1S/C13H25N4OP.C2H6/c1-2-12-11-17(16-15-12)9-6-8-14-13(18)7-4-3-5-10-19;1-2/h11H,2-10,19H2,1H3,(H,14,18);1-2H3 |
| InChIKey | PKDHDCNAOATCJG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|