C8H16N6O — CID 156794759
3-[4-(methylaminomethyl)triazol-1-yl]propylurea (PubChem CID 156794759) has the molecular formula C8H16N6O and a molecular weight of 212.26 g/mol. Its IUPAC name is 3-[4-(methylaminomethyl)triazol-1-yl]propylurea.
| Compound Name | 3-[4-(methylaminomethyl)triazol-1-yl]propylurea |
|---|---|
| PubChem CID | 156794759 |
| Molecular Formula | C8H16N6O |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-[4-(methylaminomethyl)triazol-1-yl]propylurea |
| SMILES | CNCc1cn(CCCNC(N)=O)nn1 |
| InChI | InChI=1S/C8H16N6O/c1-10-5-7-6-14(13-12-7)4-2-3-11-8(9)15/h6,10H,2-5H2,1H3,(H3,9,11,15) |
| InChIKey | UDVHYZBQHBCYTP-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|