C11H23N5OS — CID 156802536
ethane;[1-[3-(ethylamino)propyl]triazol-4-yl]methylcarbamothioic S-acid (PubChem CID 156802536) has the molecular formula C11H23N5OS and a molecular weight of 273.41 g/mol. Its IUPAC name is ethane;[1-[3-(ethylamino)propyl]triazol-4-yl]methylcarbamothioic S-acid.
| Compound Name | ethane;[1-[3-(ethylamino)propyl]triazol-4-yl]methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 156802536 |
| Molecular Formula | C11H23N5OS |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | ethane;[1-[3-(ethylamino)propyl]triazol-4-yl]methylcarbamothioic S-acid |
| SMILES | CC.CCNCCCn1cc(CNC(=O)S)nn1 |
| InChI | InChI=1S/C9H17N5OS.C2H6/c1-2-10-4-3-5-14-7-8(12-13-14)6-11-9(15)16;1-2/h7,10H,2-6H2,1H3,(H2,11,15,16);1-2H3 |
| InChIKey | NDKGVJDKEXSSPW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|