C11H21N5O — CID 170201876
N-[2-[1-[3-(ethylamino)propyl]triazol-4-yl]ethyl]acetamide (PubChem CID 170201876) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[2-[1-[3-(ethylamino)propyl]triazol-4-yl]ethyl]acetamide.
| Compound Name | N-[2-[1-[3-(ethylamino)propyl]triazol-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 170201876 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[2-[1-[3-(ethylamino)propyl]triazol-4-yl]ethyl]acetamide |
| SMILES | CCNCCCn1cc(CCNC(C)=O)nn1 |
| InChI | InChI=1S/C11H21N5O/c1-3-12-6-4-8-16-9-11(14-15-16)5-7-13-10(2)17/h9,12H,3-8H2,1-2H3,(H,13,17) |
| InChIKey | YQWAXLWZEDQTDD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|