C9H16N4O2 — CID 62399822
N-ethyl-3-[4-(2-hydroxyethyl)triazol-1-yl]propanamide (PubChem CID 62399822) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-ethyl-3-[4-(2-hydroxyethyl)triazol-1-yl]propanamide.
| Compound Name | N-ethyl-3-[4-(2-hydroxyethyl)triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 62399822 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-ethyl-3-[4-(2-hydroxyethyl)triazol-1-yl]propanamide |
| SMILES | CCNC(=O)CCn1cc(CCO)nn1 |
| InChI | InChI=1S/C9H16N4O2/c1-2-10-9(15)3-5-13-7-8(4-6-14)11-12-13/h7,14H,2-6H2,1H3,(H,10,15) |
| InChIKey | OVXOKDZGNQZZQY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |