C22H42N4O6 — CID 176686546
N-[2-[2-[2-[2-[2-[1-(2-propoxyethyl)triazol-4-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 176686546) has the molecular formula C22H42N4O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[1-(2-propoxyethyl)triazol-4-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | N-[2-[2-[2-[2-[2-[1-(2-propoxyethyl)triazol-4-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 176686546 |
| Molecular Formula | C22H42N4O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[1-(2-propoxyethyl)triazol-4-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCOCCOCCOCCOCCc1cn(CCOCCC)nn1 |
| InChI | InChI=1S/C22H42N4O6/c1-3-5-6-22(27)23-8-12-30-15-17-32-19-18-31-16-14-29-11-7-21-20-26(25-24-21)9-13-28-10-4-2/h20H,3-19H2,1-2H3,(H,23,27) |
| InChIKey | MMHWEQGSRZGVIO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|