C24H46N4O5 — CID 169018887
3-methyl-N-[2-[2-[2-[2-[2-[4-(5-methylhexyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 169018887) has the molecular formula C24H46N4O5 and a molecular weight of 470.66 g/mol. Its IUPAC name is 3-methyl-N-[2-[2-[2-[2-[2-[4-(5-methylhexyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 3-methyl-N-[2-[2-[2-[2-[2-[4-(5-methylhexyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 169018887 |
| Molecular Formula | C24H46N4O5 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | 3-methyl-N-[2-[2-[2-[2-[2-[4-(5-methylhexyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CC(C)CCCCc1cn(CCOCCOCCOCCOCCNC(=O)CC(C)C)nn1 |
| InChI | InChI=1S/C24H46N4O5/c1-21(2)7-5-6-8-23-20-28(27-26-23)10-12-31-14-16-33-18-17-32-15-13-30-11-9-25-24(29)19-22(3)4/h20-22H,5-19H2,1-4H3,(H,25,29) |
| InChIKey | UBZUKJUPIBRWNP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|