C17H32N4O4 — CID 157240697
2-methyl-N-[2-[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethyl]propanamide (PubChem CID 157240697) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-methyl-N-[2-[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 157240697 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-methyl-N-[2-[1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethyl]propanamide |
| SMILES | CCCOCCOCCOCCn1cc(CCNC(=O)C(C)C)nn1 |
| InChI | InChI=1S/C17H32N4O4/c1-4-8-23-10-12-25-13-11-24-9-7-21-14-16(19-20-21)5-6-18-17(22)15(2)3/h14-15H,4-13H2,1-3H3,(H,18,22) |
| InChIKey | HIECCSRBMCXIEK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|