C21H40N4O4 — CID 178007945
ethane;(Z)-5-methyl-4-oxo-N-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]hex-2-enamide (PubChem CID 178007945) has the molecular formula C21H40N4O4 and a molecular weight of 412.58 g/mol. Its IUPAC name is ethane;(Z)-5-methyl-4-oxo-N-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]hex-2-enamide.
| Compound Name | ethane;(Z)-5-methyl-4-oxo-N-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]hex-2-enamide |
|---|---|
| PubChem CID | 178007945 |
| Molecular Formula | C21H40N4O4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | ethane;(Z)-5-methyl-4-oxo-N-[[1-[2-(2-propoxyethoxy)ethyl]triazol-4-yl]methyl]hex-2-enamide |
| SMILES | CC.CC.CCCOCCOCCn1cc(CNC(=O)/C=C\C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C17H28N4O4.2C2H6/c1-4-8-24-10-11-25-9-7-21-13-15(19-20-21)12-18-17(23)6-5-16(22)14(2)3;2*1-2/h5-6,13-14H,4,7-12H2,1-3H3,(H,18,23);2*1-2H3/b6-5-;; |
| InChIKey | QZEKOOFJUSLTPB-XNOMRPDFSA-N |
| XLogP | 3.17 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|