C20H34N4O5 — CID 167420731
(Z)-5-methyl-N-[[1-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide (PubChem CID 167420731) has the molecular formula C20H34N4O5 and a molecular weight of 410.52 g/mol. Its IUPAC name is (Z)-5-methyl-N-[[1-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide.
| Compound Name | (Z)-5-methyl-N-[[1-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 167420731 |
| Molecular Formula | C20H34N4O5 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (Z)-5-methyl-N-[[1-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide |
| SMILES | CC(C)COCCOCCOCCn1cc(CNC(=O)/C=C\C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C20H34N4O5/c1-16(2)15-29-12-11-28-10-9-27-8-7-24-14-18(22-23-24)13-21-20(26)6-5-19(25)17(3)4/h5-6,14,16-17H,7-13,15H2,1-4H3,(H,21,26)/b6-5- |
| InChIKey | HJNQARDJGMXQLT-WAYWQWQTSA-N |
| XLogP | 1.38 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|