C16H24N4O4 — CID 170044800
propyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate (PubChem CID 170044800) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is propyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate.
| Compound Name | propyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate |
|---|---|
| PubChem CID | 170044800 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | propyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate |
| SMILES | CCCOC(=O)CCn1cc(CNC(=O)/C=C\C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C16H24N4O4/c1-4-9-24-16(23)7-8-20-11-13(18-19-20)10-17-15(22)6-5-14(21)12(2)3/h5-6,11-12H,4,7-10H2,1-3H3,(H,17,22)/b6-5- |
| InChIKey | ADAHSDFJMXADES-WAYWQWQTSA-N |
| XLogP | 1.02 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|