C24H42N4O7 — CID 167420656
(Z)-5-methyl-N-[[1-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide (PubChem CID 167420656) has the molecular formula C24H42N4O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is (Z)-5-methyl-N-[[1-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide.
| Compound Name | (Z)-5-methyl-N-[[1-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 167420656 |
| Molecular Formula | C24H42N4O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | (Z)-5-methyl-N-[[1-[2-[2-[2-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-4-oxohex-2-enamide |
| SMILES | CC(C)COCCOCCOCCOCCOCCn1cc(CNC(=O)/C=C\C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C24H42N4O7/c1-20(2)19-35-16-15-34-14-13-33-12-11-32-10-9-31-8-7-28-18-22(26-27-28)17-25-24(30)6-5-23(29)21(3)4/h5-6,18,20-21H,7-17,19H2,1-4H3,(H,25,30)/b6-5- |
| InChIKey | HOTKHNQOIOASPR-WAYWQWQTSA-N |
| XLogP | 1.41 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|