C15H24N4O4 — CID 178007764
2-methylpropyl 3-[4-[[[(Z)-4-oxopent-2-enoyl]amino]methyl]triazol-1-yl]propanoate;molecular hydrogen (PubChem CID 178007764) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-methylpropyl 3-[4-[[[(Z)-4-oxopent-2-enoyl]amino]methyl]triazol-1-yl]propanoate;molecular hydrogen.
| Compound Name | 2-methylpropyl 3-[4-[[[(Z)-4-oxopent-2-enoyl]amino]methyl]triazol-1-yl]propanoate;molecular hydrogen |
|---|---|
| PubChem CID | 178007764 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-methylpropyl 3-[4-[[[(Z)-4-oxopent-2-enoyl]amino]methyl]triazol-1-yl]propanoate;molecular hydrogen |
| SMILES | CC(=O)/C=C\C(=O)NCc1cn(CCC(=O)OCC(C)C)nn1.[H][H] |
| InChI | InChI=1S/C15H22N4O4.H2/c1-11(2)10-23-15(22)6-7-19-9-13(17-18-19)8-16-14(21)5-4-12(3)20;/h4-5,9,11H,6-8,10H2,1-3H3,(H,16,21);1H/b5-4-; |
| InChIKey | XZFJGGFADWDYQS-MKWAYWHRSA-N |
| XLogP | 0.87 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|