C15H26N4O2 — CID 155323027
4,4-dimethyl-N-[[1-(5-oxopentyl)triazol-4-yl]methyl]pentanamide (PubChem CID 155323027) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4,4-dimethyl-N-[[1-(5-oxopentyl)triazol-4-yl]methyl]pentanamide.
| Compound Name | 4,4-dimethyl-N-[[1-(5-oxopentyl)triazol-4-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 155323027 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4,4-dimethyl-N-[[1-(5-oxopentyl)triazol-4-yl]methyl]pentanamide |
| SMILES | CC(C)(C)CCC(=O)NCc1cn(CCCCC=O)nn1 |
| InChI | InChI=1S/C15H26N4O2/c1-15(2,3)8-7-14(21)16-11-13-12-19(18-17-13)9-5-4-6-10-20/h10,12H,4-9,11H2,1-3H3,(H,16,21) |
| InChIKey | CQSZQBWFLWZDHP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|