C18H26N6O5 — CID 167870047
4-[4-[[[3-[(4-tert-butyl-1,2-oxazol-3-yl)methylamino]-3-oxopropanoyl]amino]methyl]triazol-1-yl]butanoic acid (PubChem CID 167870047) has the molecular formula C18H26N6O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-[4-[[[3-[(4-tert-butyl-1,2-oxazol-3-yl)methylamino]-3-oxopropanoyl]amino]methyl]triazol-1-yl]butanoic acid.
| Compound Name | 4-[4-[[[3-[(4-tert-butyl-1,2-oxazol-3-yl)methylamino]-3-oxopropanoyl]amino]methyl]triazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 167870047 |
| Molecular Formula | C18H26N6O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-[4-[[[3-[(4-tert-butyl-1,2-oxazol-3-yl)methylamino]-3-oxopropanoyl]amino]methyl]triazol-1-yl]butanoic acid |
| SMILES | CC(C)(C)c1conc1CNC(=O)CC(=O)NCc1cn(CCCC(=O)O)nn1 |
| InChI | InChI=1S/C18H26N6O5/c1-18(2,3)13-11-29-22-14(13)9-20-16(26)7-15(25)19-8-12-10-24(23-21-12)6-4-5-17(27)28/h10-11H,4-9H2,1-3H3,(H,19,25)(H,20,26)(H,27,28) |
| InChIKey | MECVDZDUBIPKJX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 152.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|