C23H45N3 — CID 155620964
1-(9,9-dimethyldecyl)-4-(6,6-dimethylheptyl)triazole (PubChem CID 155620964) has the molecular formula C23H45N3 and a molecular weight of 363.63 g/mol. Its IUPAC name is 1-(9,9-dimethyldecyl)-4-(6,6-dimethylheptyl)triazole.
| Compound Name | 1-(9,9-dimethyldecyl)-4-(6,6-dimethylheptyl)triazole |
|---|---|
| PubChem CID | 155620964 |
| Molecular Formula | C23H45N3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | 1-(9,9-dimethyldecyl)-4-(6,6-dimethylheptyl)triazole |
| SMILES | CC(C)(C)CCCCCCCCn1cc(CCCCCC(C)(C)C)nn1 |
| InChI | InChI=1S/C23H45N3/c1-22(2,3)17-13-9-7-8-10-15-19-26-20-21(24-25-26)16-12-11-14-18-23(4,5)6/h20H,7-19H2,1-6H3 |
| InChIKey | MYFBZUQOGFXMKF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|