C17H28N4O2 — CID 166462563
1-[2-[1-(5,5-dimethylhexyl)triazol-4-yl]ethyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 166462563) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[2-[1-(5,5-dimethylhexyl)triazol-4-yl]ethyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-[1-(5,5-dimethylhexyl)triazol-4-yl]ethyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166462563 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[2-[1-(5,5-dimethylhexyl)triazol-4-yl]ethyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CCc2cn(CCCCC(C)(C)C)nn2)C1=O |
| InChI | InChI=1S/C17H28N4O2/c1-13-11-15(22)21(16(13)23)10-7-14-12-20(19-18-14)9-6-5-8-17(2,3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | BBALEZYNVVBLGW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|