C17H33N3 — CID 138467323
1-(7,7-dimethyloctyl)-4-(2,2-dimethylpropyl)triazole (PubChem CID 138467323) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-(7,7-dimethyloctyl)-4-(2,2-dimethylpropyl)triazole.
| Compound Name | 1-(7,7-dimethyloctyl)-4-(2,2-dimethylpropyl)triazole |
|---|---|
| PubChem CID | 138467323 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 1-(7,7-dimethyloctyl)-4-(2,2-dimethylpropyl)triazole |
| SMILES | CC(C)(C)CCCCCCn1cc(CC(C)(C)C)nn1 |
| InChI | InChI=1S/C17H33N3/c1-16(2,3)11-9-7-8-10-12-20-14-15(18-19-20)13-17(4,5)6/h14H,7-13H2,1-6H3 |
| InChIKey | UEPFJVQQDLZNHC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|