C14H27N3O — CID 171587035
1-(3,3-dimethylbutoxymethyl)-4-(2,2-dimethylpropyl)triazole (PubChem CID 171587035) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxymethyl)-4-(2,2-dimethylpropyl)triazole.
| Compound Name | 1-(3,3-dimethylbutoxymethyl)-4-(2,2-dimethylpropyl)triazole |
|---|---|
| PubChem CID | 171587035 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 1-(3,3-dimethylbutoxymethyl)-4-(2,2-dimethylpropyl)triazole |
| SMILES | CC(C)(C)CCOCn1cc(CC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H27N3O/c1-13(2,3)7-8-18-11-17-10-12(15-16-17)9-14(4,5)6/h10H,7-9,11H2,1-6H3 |
| InChIKey | WAORMWZUMMVHJB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|