C15H29N3O — CID 177117041
1-[3-(3,3-dimethylbutoxy)propyl]-4-(2-methylpropyl)triazole (PubChem CID 177117041) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-[3-(3,3-dimethylbutoxy)propyl]-4-(2-methylpropyl)triazole.
| Compound Name | 1-[3-(3,3-dimethylbutoxy)propyl]-4-(2-methylpropyl)triazole |
|---|---|
| PubChem CID | 177117041 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 1-[3-(3,3-dimethylbutoxy)propyl]-4-(2-methylpropyl)triazole |
| SMILES | CC(C)Cc1cn(CCCOCCC(C)(C)C)nn1 |
| InChI | InChI=1S/C15H29N3O/c1-13(2)11-14-12-18(17-16-14)8-6-9-19-10-7-15(3,4)5/h12-13H,6-11H2,1-5H3 |
| InChIKey | NFNAOIPYJDDAOP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|