C20H39N3O3 — CID 170092527
4-(3,3-dimethylbutyl)-1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazole (PubChem CID 170092527) has the molecular formula C20H39N3O3 and a molecular weight of 369.55 g/mol. Its IUPAC name is 4-(3,3-dimethylbutyl)-1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazole.
| Compound Name | 4-(3,3-dimethylbutyl)-1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazole |
|---|---|
| PubChem CID | 170092527 |
| Molecular Formula | C20H39N3O3 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | 4-(3,3-dimethylbutyl)-1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazole |
| SMILES | CC(C)CCCOCCOCCOCCn1cc(CCC(C)(C)C)nn1 |
| InChI | InChI=1S/C20H39N3O3/c1-18(2)7-6-11-24-13-15-26-16-14-25-12-10-23-17-19(21-22-23)8-9-20(3,4)5/h17-18H,6-16H2,1-5H3 |
| InChIKey | WJPXLGJDVJEULL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|