C26H47N3O2 — CID 58408548
4-[6-(3,3-dimethylbutoxy)-3-methylidenehexyl]-1-[2-(5,5-dimethyl-4-methylidenehexoxy)ethyl]triazole (PubChem CID 58408548) has the molecular formula C26H47N3O2 and a molecular weight of 433.68 g/mol. Its IUPAC name is 4-[6-(3,3-dimethylbutoxy)-3-methylidenehexyl]-1-[2-(5,5-dimethyl-4-methylidenehexoxy)ethyl]triazole.
| Compound Name | 4-[6-(3,3-dimethylbutoxy)-3-methylidenehexyl]-1-[2-(5,5-dimethyl-4-methylidenehexoxy)ethyl]triazole |
|---|---|
| PubChem CID | 58408548 |
| Molecular Formula | C26H47N3O2 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.37 |
| IUPAC Name | 4-[6-(3,3-dimethylbutoxy)-3-methylidenehexyl]-1-[2-(5,5-dimethyl-4-methylidenehexoxy)ethyl]triazole |
| SMILES | C=C(CCCOCCC(C)(C)C)CCc1cn(CCOCCCC(=C)C(C)(C)C)nn1 |
| InChI | InChI=1S/C26H47N3O2/c1-22(11-9-17-30-19-15-25(3,4)5)13-14-24-21-29(28-27-24)16-20-31-18-10-12-23(2)26(6,7)8/h21H,1-2,9-20H2,3-8H3 |
| InChIKey | QLFUFKSYKVEZMN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|