C15H29N3OU — CID 164736361
1-[2-(3,3-dimethylbutoxy)ethyl]-4-methanidyltriazole;2-methylpropane;uranium(2+) (PubChem CID 164736361) has the molecular formula C15H29N3OU and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-[2-(3,3-dimethylbutoxy)ethyl]-4-methanidyltriazole;2-methylpropane;uranium(2+).
| Compound Name | 1-[2-(3,3-dimethylbutoxy)ethyl]-4-methanidyltriazole;2-methylpropane;uranium(2+) |
|---|---|
| PubChem CID | 164736361 |
| Molecular Formula | C15H29N3OU |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 1-[2-(3,3-dimethylbutoxy)ethyl]-4-methanidyltriazole;2-methylpropane;uranium(2+) |
| SMILES | C[C-](C)C.[CH2-]c1cn(CCOCCC(C)(C)C)nn1.[U+2] |
| InChI | InChI=1S/C11H20N3O.C4H9.U/c1-10-9-14(13-12-10)6-8-15-7-5-11(2,3)4;1-4(2)3;/h9H,1,5-8H2,2-4H3;1-3H3;/q2*-1;+2 |
| InChIKey | NLGJYQQKKRHXJC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|