C15H29N3O2 — CID 164700684
4-(2,2-dimethylpropyl)-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]triazole (PubChem CID 164700684) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]triazole.
| Compound Name | 4-(2,2-dimethylpropyl)-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]triazole |
|---|---|
| PubChem CID | 164700684 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethyl]triazole |
| SMILES | CC(C)(C)Cc1cn(CCOCCOC(C)(C)C)nn1 |
| InChI | InChI=1S/C15H29N3O2/c1-14(2,3)11-13-12-18(17-16-13)7-8-19-9-10-20-15(4,5)6/h12H,7-11H2,1-6H3 |
| InChIKey | AKEHMQYYCLREPN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|