C19H37N3O4 — CID 163269188
ethane;1-[1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]propan-1-one (PubChem CID 163269188) has the molecular formula C19H37N3O4 and a molecular weight of 371.52 g/mol. Its IUPAC name is ethane;1-[1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]propan-1-one.
| Compound Name | ethane;1-[1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 163269188 |
| Molecular Formula | C19H37N3O4 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | ethane;1-[1-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]propan-1-one |
| SMILES | CC.CCC(=O)c1cn(CCOCCOCCOCCCC(C)C)nn1 |
| InChI | InChI=1S/C17H31N3O4.C2H6/c1-4-17(21)16-14-20(19-18-16)7-9-23-11-13-24-12-10-22-8-5-6-15(2)3;1-2/h14-15H,4-13H2,1-3H3;1-2H3 |
| InChIKey | FIMCMSQRAFCGCW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|