C21H43N5O4 — CID 171554594
ethane;N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-1-(4-methylpentyl)triazole-4-carboxamide;propanal (PubChem CID 171554594) has the molecular formula C21H43N5O4 and a molecular weight of 429.61 g/mol. Its IUPAC name is ethane;N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-1-(4-methylpentyl)triazole-4-carboxamide;propanal.
| Compound Name | ethane;N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-1-(4-methylpentyl)triazole-4-carboxamide;propanal |
|---|---|
| PubChem CID | 171554594 |
| Molecular Formula | C21H43N5O4 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.33 |
| IUPAC Name | ethane;N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-1-(4-methylpentyl)triazole-4-carboxamide;propanal |
| SMILES | CC.CCC=O.CNCCOCCOCCNC(=O)c1cn(CCCC(C)C)nn1 |
| InChI | InChI=1S/C16H31N5O3.C3H6O.C2H6/c1-14(2)5-4-8-21-13-15(19-20-21)16(22)18-7-10-24-12-11-23-9-6-17-3;1-2-3-4;1-2/h13-14,17H,4-12H2,1-3H3,(H,18,22);3H,2H2,1H3;1-2H3 |
| InChIKey | KZCXYNHYWCZDAY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|