C9H13N5O5 — CID 106240403
2-[4-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid (PubChem CID 106240403) has the molecular formula C9H13N5O5 and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-[4-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 106240403 |
| Molecular Formula | C9H13N5O5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[4-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid |
| SMILES | NC(=O)COCCNC(=O)c1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C9H13N5O5/c10-7(15)5-19-2-1-11-9(18)6-3-14(13-12-6)4-8(16)17/h3H,1-2,4-5H2,(H2,10,15)(H,11,18)(H,16,17) |
| InChIKey | QUVNHYVABVFFOB-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|