C9H11F3N4O4 — CID 66288366
2-[4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid (PubChem CID 66288366) has the molecular formula C9H11F3N4O4 and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-[4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 66288366 |
| Molecular Formula | C9H11F3N4O4 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-[4-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)NCCOCC(F)(F)F)nn1 |
| InChI | InChI=1S/C9H11F3N4O4/c10-9(11,12)5-20-2-1-13-8(19)6-3-16(15-14-6)4-7(17)18/h3H,1-2,4-5H2,(H,13,19)(H,17,18) |
| InChIKey | WFESYBJDWIOHSP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|