C23H42N4O4 — CID 138737710
3-[1-(5-methylheptyl)triazol-4-yl]-N-[2-[2-(3-methyl-2-oxopentoxy)ethoxy]ethyl]propanamide (PubChem CID 138737710) has the molecular formula C23H42N4O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3-[1-(5-methylheptyl)triazol-4-yl]-N-[2-[2-(3-methyl-2-oxopentoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-[1-(5-methylheptyl)triazol-4-yl]-N-[2-[2-(3-methyl-2-oxopentoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 138737710 |
| Molecular Formula | C23H42N4O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 3-[1-(5-methylheptyl)triazol-4-yl]-N-[2-[2-(3-methyl-2-oxopentoxy)ethoxy]ethyl]propanamide |
| SMILES | CCC(C)CCCCn1cc(CCC(=O)NCCOCCOCC(=O)C(C)CC)nn1 |
| InChI | InChI=1S/C23H42N4O4/c1-5-19(3)9-7-8-13-27-17-21(25-26-27)10-11-23(29)24-12-14-30-15-16-31-18-22(28)20(4)6-2/h17,19-20H,5-16,18H2,1-4H3,(H,24,29) |
| InChIKey | KFNCTYSQCBPGES-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|