C22H41N3O5 — CID 178080688
3-methyl-1-[2-[2-[2-[(1-octyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]butan-2-one (PubChem CID 178080688) has the molecular formula C22H41N3O5 and a molecular weight of 427.59 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-[2-[(1-octyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]butan-2-one.
| Compound Name | 3-methyl-1-[2-[2-[2-[(1-octyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 178080688 |
| Molecular Formula | C22H41N3O5 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | 3-methyl-1-[2-[2-[2-[(1-octyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]butan-2-one |
| SMILES | CCCCCCCCn1cc(COCCOCCOCCOCC(=O)C(C)C)nn1 |
| InChI | InChI=1S/C22H41N3O5/c1-4-5-6-7-8-9-10-25-17-21(23-24-25)18-29-15-13-27-11-12-28-14-16-30-19-22(26)20(2)3/h17,20H,4-16,18-19H2,1-3H3 |
| InChIKey | RHWGMCWBQFVRNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|