C18H33N3O5 — CID 154684338
4-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxymethyl]triazol-1-yl]pentan-3-one (PubChem CID 154684338) has the molecular formula C18H33N3O5 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxymethyl]triazol-1-yl]pentan-3-one.
| Compound Name | 4-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxymethyl]triazol-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 154684338 |
| Molecular Formula | C18H33N3O5 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 4-methyl-1-[4-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxymethyl]triazol-1-yl]pentan-3-one |
| SMILES | CC(C)OCCOCCOCCOCc1cn(CCC(=O)C(C)C)nn1 |
| InChI | InChI=1S/C18H33N3O5/c1-15(2)18(22)5-6-21-13-17(19-20-21)14-25-10-9-23-7-8-24-11-12-26-16(3)4/h13,15-16H,5-12,14H2,1-4H3 |
| InChIKey | JCASDIHYSWMNGR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|