C19H33N3O5 — CID 138632876
2-methyl-7-[4-[2-[2-(3-oxobutoxy)ethoxy]ethoxymethyl]triazol-1-yl]heptan-3-one (PubChem CID 138632876) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-methyl-7-[4-[2-[2-(3-oxobutoxy)ethoxy]ethoxymethyl]triazol-1-yl]heptan-3-one.
| Compound Name | 2-methyl-7-[4-[2-[2-(3-oxobutoxy)ethoxy]ethoxymethyl]triazol-1-yl]heptan-3-one |
|---|---|
| PubChem CID | 138632876 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 2-methyl-7-[4-[2-[2-(3-oxobutoxy)ethoxy]ethoxymethyl]triazol-1-yl]heptan-3-one |
| SMILES | CC(=O)CCOCCOCCOCc1cn(CCCCC(=O)C(C)C)nn1 |
| InChI | InChI=1S/C19H33N3O5/c1-16(2)19(24)6-4-5-8-22-14-18(20-21-22)15-27-13-12-26-11-10-25-9-7-17(3)23/h14,16H,4-13,15H2,1-3H3 |
| InChIKey | JVCNZOOBXCBTMK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|