C23H36N4O6S — CID 178093626
N-methyl-N-[4-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]butane-1-sulfonamide (PubChem CID 178093626) has the molecular formula C23H36N4O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-methyl-N-[4-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]butane-1-sulfonamide.
| Compound Name | N-methyl-N-[4-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 178093626 |
| Molecular Formula | C23H36N4O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-methyl-N-[4-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N(C)c1ccc(OCc2cn(CCOCCOCC(=O)C(C)C)nn2)cc1 |
| InChI | InChI=1S/C23H36N4O6S/c1-5-6-15-34(29,30)26(4)21-7-9-22(10-8-21)33-17-20-16-27(25-24-20)11-12-31-13-14-32-18-23(28)19(2)3/h7-10,16,19H,5-6,11-15,17-18H2,1-4H3 |
| InChIKey | PBGHPMQYRWESPB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|